C23H28N4O5S — CID 55408550
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(1-methylbenzimidazol-2-yl)methyl]hexanamide (PubChem CID 55408550) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(1-methylbenzimidazol-2-yl)methyl]hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(1-methylbenzimidazol-2-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 55408550 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(1-methylbenzimidazol-2-yl)methyl]hexanamide |
| SMILES | Cn1c(CNC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)nc2ccccc21 |
| InChI | InChI=1S/C23H28N4O5S/c1-27-19-8-5-4-7-18(19)26-22(27)16-24-23(28)9-3-2-6-12-25-33(29,30)17-10-11-20-21(15-17)32-14-13-31-20/h4-5,7-8,10-11,15,25H,2-3,6,9,12-14,16H2,1H3,(H,24,28) |
| InChIKey | PRLFYADUSSBLIP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|