C23H29ClN2O5S — CID 24613385
N-[1-(4-chlorophenyl)propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 24613385) has the molecular formula C23H29ClN2O5S and a molecular weight of 481.01 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-[1-(4-chlorophenyl)propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 24613385 |
| Molecular Formula | C23H29ClN2O5S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[1-(4-chlorophenyl)propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | CCC(NC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN2O5S/c1-2-20(17-7-9-18(24)10-8-17)26-23(27)6-4-3-5-13-25-32(28,29)19-11-12-21-22(16-19)31-15-14-30-21/h7-12,16,20,25H,2-6,13-15H2,1H3,(H,26,27) |
| InChIKey | FHCNFJDFKXOWCZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|