C23H29ClN2O5S — CID 55580264
N-[1-(3-chlorophenyl)ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-methylhexanamide (PubChem CID 55580264) has the molecular formula C23H29ClN2O5S and a molecular weight of 481.01 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-methylhexanamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-methylhexanamide |
|---|---|
| PubChem CID | 55580264 |
| Molecular Formula | C23H29ClN2O5S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-methylhexanamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)C(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H29ClN2O5S/c1-17(18-7-6-8-19(24)15-18)26(2)23(27)9-4-3-5-12-25-32(28,29)20-10-11-21-22(16-20)31-14-13-30-21/h6-8,10-11,15-17,25H,3-5,9,12-14H2,1-2H3 |
| InChIKey | OWJDTOINTIPAGL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|