C24H30N2O5S — CID 55540063
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylhexanamide (PubChem CID 55540063) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylhexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylhexanamide |
|---|---|
| PubChem CID | 55540063 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylhexanamide |
| SMILES | CN(C(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)C1CCc2ccccc21 |
| InChI | InChI=1S/C24H30N2O5S/c1-26(21-12-10-18-7-4-5-8-20(18)21)24(27)9-3-2-6-14-25-32(28,29)19-11-13-22-23(17-19)31-16-15-30-22/h4-5,7-8,11,13,17,21,25H,2-3,6,9-10,12,14-16H2,1H3 |
| InChIKey | QKYGUMHHRVSIAZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|