C24H39N3O5S — CID 55827567
N-[3-[cyclohexyl(methyl)amino]propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 55827567) has the molecular formula C24H39N3O5S and a molecular weight of 481.66 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 55827567 |
| Molecular Formula | C24H39N3O5S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | CN(CCCNC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)C1CCCCC1 |
| InChI | InChI=1S/C24H39N3O5S/c1-27(20-9-4-2-5-10-20)16-8-14-25-24(28)11-6-3-7-15-26-33(29,30)21-12-13-22-23(19-21)32-18-17-31-22/h12-13,19-20,26H,2-11,14-18H2,1H3,(H,25,28) |
| InChIKey | VOLMKZZOWGSSFT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|