C18H29N3O5S — CID 119499319
N-(3-aminobutyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 119499319) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is N-(3-aminobutyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-(3-aminobutyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 119499319 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(3-aminobutyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | CC(N)CCNC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H29N3O5S/c1-14(19)8-10-20-18(22)5-3-2-4-9-21-27(23,24)15-6-7-16-17(13-15)26-12-11-25-16/h6-7,13-14,21H,2-5,8-12,19H2,1H3,(H,20,22) |
| InChIKey | CZGKFITZCYQEHP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|