C13H19NO5S — CID 107271149
N-(4-hydroxypentyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 107271149) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(4-hydroxypentyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 107271149 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(4-hydroxypentyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CC(O)CCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H19NO5S/c1-10(15)3-2-6-14-20(16,17)11-4-5-12-13(9-11)19-8-7-18-12/h4-5,9-10,14-15H,2-3,6-8H2,1H3 |
| InChIKey | LUORXCSVHLKWOP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|