C12H16BrNO4S — CID 113271819
N-(3-bromobutyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 113271819) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is N-(3-bromobutyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(3-bromobutyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 113271819 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(3-bromobutyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CC(Br)CCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H16BrNO4S/c1-9(13)4-5-14-19(15,16)10-2-3-11-12(8-10)18-7-6-17-11/h2-3,8-9,14H,4-7H2,1H3 |
| InChIKey | FSJQXWXEDICRHX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|