C16H26Cl2N4O — CID 119834811
7-amino-N-[(1-methylbenzimidazol-2-yl)methyl]heptanamide;dihydrochloride (PubChem CID 119834811) has the molecular formula C16H26Cl2N4O and a molecular weight of 361.32 g/mol. Its IUPAC name is 7-amino-N-[(1-methylbenzimidazol-2-yl)methyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[(1-methylbenzimidazol-2-yl)methyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119834811 |
| Molecular Formula | C16H26Cl2N4O |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 7-amino-N-[(1-methylbenzimidazol-2-yl)methyl]heptanamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(CNC(=O)CCCCCCN)nc2ccccc21 |
| InChI | InChI=1S/C16H24N4O.2ClH/c1-20-14-9-6-5-8-13(14)19-15(20)12-18-16(21)10-4-2-3-7-11-17;;/h5-6,8-9H,2-4,7,10-12,17H2,1H3,(H,18,21);2*1H |
| InChIKey | UDIHNAOYNZQALE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|