C20H22N4O2 — CID 134012185
N-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2-phenylacetyl)amino]propanamide (PubChem CID 134012185) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2-phenylacetyl)amino]propanamide.
| Compound Name | N-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 134012185 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2-phenylacetyl)amino]propanamide |
| SMILES | Cn1c(CNC(=O)CCNC(=O)Cc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C20H22N4O2/c1-24-17-10-6-5-9-16(17)23-18(24)14-22-19(25)11-12-21-20(26)13-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | WESCKFCLUZIKLR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |