C20H28N4O5S2 — CID 24647753
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]hexanamide (PubChem CID 24647753) has the molecular formula C20H28N4O5S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 24647753 |
| Molecular Formula | C20H28N4O5S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]hexanamide |
| SMILES | CC(C)Cc1nnc(NC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C20H28N4O5S2/c1-14(2)12-19-23-24-20(30-19)22-18(25)6-4-3-5-9-21-31(26,27)15-7-8-16-17(13-15)29-11-10-28-16/h7-8,13-14,21H,3-6,9-12H2,1-2H3,(H,22,24,25) |
| InChIKey | SYNWTCGWTKTSCL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|