C16H22N2O3S — CID 11370695
S-[2-[(6-anilino-6-oxohexyl)amino]-2-oxoethyl] ethanethioate (PubChem CID 11370695) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is S-[2-[(6-anilino-6-oxohexyl)amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[(6-anilino-6-oxohexyl)amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11370695 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | S-[2-[(6-anilino-6-oxohexyl)amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-13(19)22-12-16(21)17-11-7-3-6-10-15(20)18-14-8-4-2-5-9-14/h2,4-5,8-9H,3,6-7,10-12H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | YJSCVICYEOPEPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|