C20H25N3O2S — CID 58756911
6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-phenylhexanamide (PubChem CID 58756911) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-phenylhexanamide.
| Compound Name | 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-phenylhexanamide |
|---|---|
| PubChem CID | 58756911 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-phenylhexanamide |
| SMILES | Nc1ccc(SCC(=O)NCCCCCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O2S/c21-16-10-12-18(13-11-16)26-15-20(25)22-14-6-2-5-9-19(24)23-17-7-3-1-4-8-17/h1,3-4,7-8,10-13H,2,5-6,9,14-15,21H2,(H,22,25)(H,23,24) |
| InChIKey | IHEOCQSQZZTLKO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|