C26H29N3O2S — CID 69384583
6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-(3-phenylphenyl)hexanamide (PubChem CID 69384583) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-(3-phenylphenyl)hexanamide.
| Compound Name | 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-(3-phenylphenyl)hexanamide |
|---|---|
| PubChem CID | 69384583 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-N-(3-phenylphenyl)hexanamide |
| SMILES | Nc1ccc(SCC(=O)NCCCCCC(=O)Nc2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H29N3O2S/c27-22-13-15-24(16-14-22)32-19-26(31)28-17-6-2-5-12-25(30)29-23-11-7-10-21(18-23)20-8-3-1-4-9-20/h1,3-4,7-11,13-16,18H,2,5-6,12,17,19,27H2,(H,28,31)(H,29,30) |
| InChIKey | MTRPDSDJHJQYTG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|