C22H26N2O5S — CID 11952973
2-[2-oxo-2-[[6-oxo-6-(3-phenylanilino)hexyl]amino]ethyl]sulfinylacetic acid (PubChem CID 11952973) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[2-oxo-2-[[6-oxo-6-(3-phenylanilino)hexyl]amino]ethyl]sulfinylacetic acid.
| Compound Name | 2-[2-oxo-2-[[6-oxo-6-(3-phenylanilino)hexyl]amino]ethyl]sulfinylacetic acid |
|---|---|
| PubChem CID | 11952973 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[2-oxo-2-[[6-oxo-6-(3-phenylanilino)hexyl]amino]ethyl]sulfinylacetic acid |
| SMILES | O=C(O)CS(=O)CC(=O)NCCCCCC(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O5S/c25-20(12-5-2-6-13-23-21(26)15-30(29)16-22(27)28)24-19-11-7-10-18(14-19)17-8-3-1-4-9-17/h1,3-4,7-11,14H,2,5-6,12-13,15-16H2,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | HFGOGGUUXGJULF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|