C23H24N4O3 — CID 108747772
N-[6-oxo-6-[3-(6-oxo-1H-pyridazin-3-yl)anilino]hexyl]benzamide (PubChem CID 108747772) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[6-oxo-6-[3-(6-oxo-1H-pyridazin-3-yl)anilino]hexyl]benzamide.
| Compound Name | N-[6-oxo-6-[3-(6-oxo-1H-pyridazin-3-yl)anilino]hexyl]benzamide |
|---|---|
| PubChem CID | 108747772 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[6-oxo-6-[3-(6-oxo-1H-pyridazin-3-yl)anilino]hexyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccccc1)Nc1cccc(-c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C23H24N4O3/c28-21(12-5-2-6-15-24-23(30)17-8-3-1-4-9-17)25-19-11-7-10-18(16-19)20-13-14-22(29)27-26-20/h1,3-4,7-11,13-14,16H,2,5-6,12,15H2,(H,24,30)(H,25,28)(H,27,29) |
| InChIKey | KEVZGTPCRKNIPV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|