C17H12BrN3O2 — CID 49035283
4-bromo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 49035283) has the molecular formula C17H12BrN3O2 and a molecular weight of 370.21 g/mol. Its IUPAC name is 4-bromo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 49035283 |
| Molecular Formula | C17H12BrN3O2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-bromo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(=O)[nH]n2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrN3O2/c18-13-6-4-11(5-7-13)17(23)19-14-3-1-2-12(10-14)15-8-9-16(22)21-20-15/h1-10H,(H,19,23)(H,21,22) |
| InChIKey | DBHHBIDTFPNVRK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |