C22H16N6O3 — CID 167918564
N-[3-[[3-(6-oxo-1H-pyridazin-3-yl)benzoyl]amino]phenyl]pyrimidine-2-carboxamide (PubChem CID 167918564) has the molecular formula C22H16N6O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is N-[3-[[3-(6-oxo-1H-pyridazin-3-yl)benzoyl]amino]phenyl]pyrimidine-2-carboxamide.
| Compound Name | N-[3-[[3-(6-oxo-1H-pyridazin-3-yl)benzoyl]amino]phenyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 167918564 |
| Molecular Formula | C22H16N6O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[3-[[3-(6-oxo-1H-pyridazin-3-yl)benzoyl]amino]phenyl]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ncccn2)c1)c1cccc(-c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C22H16N6O3/c29-19-9-8-18(27-28-19)14-4-1-5-15(12-14)21(30)25-16-6-2-7-17(13-16)26-22(31)20-23-10-3-11-24-20/h1-13H,(H,25,30)(H,26,31)(H,28,29) |
| InChIKey | LLEWYXHLPAUSCQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |