C21H15N3O2S — CID 49034810
N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 49034810) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 49034810 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(=O)[nH]n2)c1)c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H15N3O2S/c25-20-10-9-18(23-24-20)15-7-4-8-17(11-15)22-21(26)19-12-16(13-27-19)14-5-2-1-3-6-14/h1-13H,(H,22,26)(H,24,25) |
| InChIKey | XZSAJMJEUXXLKY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |