C12H11N3O3 — CID 108747797
methyl N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 108747797) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is methyl N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | methyl N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 108747797 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | methyl N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(-c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C12H11N3O3/c1-18-12(17)13-9-4-2-3-8(7-9)10-5-6-11(16)15-14-10/h2-7H,1H3,(H,13,17)(H,15,16) |
| InChIKey | SRABSJJFBHPXOU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |