C22H23N3O5 — CID 49035377
N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 49035377) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 49035377 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)Nc2cccc(-c3ccc(=O)[nH]n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O5/c1-28-18-11-14(12-19(29-2)22(18)30-3)7-9-20(26)23-16-6-4-5-15(13-16)17-8-10-21(27)25-24-17/h4-6,8,10-13H,7,9H2,1-3H3,(H,23,26)(H,25,27) |
| InChIKey | JPYPZXBPCUXCEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |