C21H21N3O4 — CID 49035162
4-(4-methoxyphenoxy)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]butanamide (PubChem CID 49035162) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 49035162 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2cccc(-c3ccc(=O)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-17-7-9-18(10-8-17)28-13-3-6-20(25)22-16-5-2-4-15(14-16)19-11-12-21(26)24-23-19/h2,4-5,7-12,14H,3,6,13H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | YKFZEMDHTVJINN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|