C18H15N3O3S — CID 108747821
4-oxo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 108747821) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-oxo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | 4-oxo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108747821 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 4-oxo-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1cccc(-c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C18H15N3O3S/c22-15(16-5-2-10-25-16)7-9-17(23)19-13-4-1-3-12(11-13)14-6-8-18(24)21-20-14/h1-6,8,10-11H,7,9H2,(H,19,23)(H,21,24) |
| InChIKey | WWWBBGQKSUTSTL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |