C17H11Cl2N3O2 — CID 49035341
2,5-dichloro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 49035341) has the molecular formula C17H11Cl2N3O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 49035341 |
| Molecular Formula | C17H11Cl2N3O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2,5-dichloro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(=O)[nH]n2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H11Cl2N3O2/c18-11-4-5-14(19)13(9-11)17(24)20-12-3-1-2-10(8-12)15-6-7-16(23)22-21-15/h1-9H,(H,20,24)(H,22,23) |
| InChIKey | KKMPDYCMJQYWDH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |