C17H11F2N3O2 — CID 49034784
3,4-difluoro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 49034784) has the molecular formula C17H11F2N3O2 and a molecular weight of 327.29 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 3,4-difluoro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 49034784 |
| Molecular Formula | C17H11F2N3O2 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3,4-difluoro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(=O)[nH]n2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H11F2N3O2/c18-13-5-4-11(9-14(13)19)17(24)20-12-3-1-2-10(8-12)15-6-7-16(23)22-21-15/h1-9H,(H,20,24)(H,22,23) |
| InChIKey | PMXWQHRSSSBQHD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |