C21H17N5O2 — CID 49033681
4-(4-methylpyrazol-1-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 49033681) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(4-methylpyrazol-1-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 4-(4-methylpyrazol-1-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 49033681 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-(4-methylpyrazol-1-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | Cc1cnn(-c2ccc(C(=O)Nc3cccc(-c4ccc(=O)[nH]n4)c3)cc2)c1 |
| InChI | InChI=1S/C21H17N5O2/c1-14-12-22-26(13-14)18-7-5-15(6-8-18)21(28)23-17-4-2-3-16(11-17)19-9-10-20(27)25-24-19/h2-13H,1H3,(H,23,28)(H,25,27) |
| InChIKey | GGRQHOIWASQEJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |