C20H17N3O5 — CID 108769827
ethyl [4-[[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108769827) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is ethyl [4-[[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108769827 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | ethyl [4-[[3-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(-c3ccc(=O)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C20H17N3O5/c1-2-27-20(26)28-16-8-6-13(7-9-16)19(25)21-15-5-3-4-14(12-15)17-10-11-18(24)23-22-17/h3-12H,2H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | JZCKIVCWNRJMKD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|