C17H15Cl2N3O — CID 82252888
2,5-dichloro-N-[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide (PubChem CID 82252888) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 82252888 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2,5-dichloro-N-[3-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C2=NCCCN2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O/c18-12-5-6-15(19)14(10-12)17(23)22-13-4-1-3-11(9-13)16-20-7-2-8-21-16/h1,3-6,9-10H,2,7-8H2,(H,20,21)(H,22,23) |
| InChIKey | HNNYAMKJAGZAAS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |