C16H14Cl2N4O — CID 66919885
1-(2,5-dichlorophenyl)-3-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea (PubChem CID 66919885) has the molecular formula C16H14Cl2N4O and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 66919885 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O/c17-11-4-5-13(18)14(9-11)22-16(23)21-12-3-1-2-10(8-12)15-19-6-7-20-15/h1-5,8-9H,6-7H2,(H,19,20)(H2,21,22,23) |
| InChIKey | OGAWQZCBPHVCEF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |