C22H24Cl2N6O2 — CID 131880365
N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]but-2-enediamide;dihydrochloride (PubChem CID 131880365) has the molecular formula C22H24Cl2N6O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]but-2-enediamide;dihydrochloride.
| Compound Name | N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]but-2-enediamide;dihydrochloride |
|---|---|
| PubChem CID | 131880365 |
| Molecular Formula | C22H24Cl2N6O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]but-2-enediamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(C=CC(=O)Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C22H22N6O2.2ClH/c29-19(27-17-5-1-3-15(13-17)21-23-9-10-24-21)7-8-20(30)28-18-6-2-4-16(14-18)22-25-11-12-26-22;;/h1-8,13-14H,9-12H2,(H,23,24)(H,25,26)(H,27,29)(H,28,30);2*1H |
| InChIKey | KRTPTLYFMPVMKA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|