C19H21N3O2 — CID 82240196
N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-4-phenoxybutanamide (PubChem CID 82240196) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-4-phenoxybutanamide.
| Compound Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 82240196 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C19H21N3O2/c23-18(10-5-13-24-17-8-2-1-3-9-17)22-16-7-4-6-15(14-16)19-20-11-12-21-19/h1-4,6-9,14H,5,10-13H2,(H,20,21)(H,22,23) |
| InChIKey | OQXBBEXBKGRSPW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|