C17H19NO2 — CID 19173641
4-(3-methylphenoxy)-N-phenylbutanamide (PubChem CID 19173641) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-N-phenylbutanamide.
| Compound Name | 4-(3-methylphenoxy)-N-phenylbutanamide |
|---|---|
| PubChem CID | 19173641 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-(3-methylphenoxy)-N-phenylbutanamide |
| SMILES | Cc1cccc(OCCCC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C17H19NO2/c1-14-7-5-10-16(13-14)20-12-6-11-17(19)18-15-8-3-2-4-9-15/h2-5,7-10,13H,6,11-12H2,1H3,(H,18,19) |
| InChIKey | VABPBARJOMUNMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|