C21H24N2O5 — CID 7147989
[2-(3-acetamidoanilino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 7147989) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7147989 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)CCCOc2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-15-6-3-9-19(12-15)27-11-5-10-21(26)28-14-20(25)23-18-8-4-7-17(13-18)22-16(2)24/h3-4,6-9,12-13H,5,10-11,14H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LNNALISJQFROLJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|