C19H20BrNO4 — CID 7212127
[2-(3-methylanilino)-2-oxoethyl] 4-(3-bromophenoxy)butanoate (PubChem CID 7212127) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 7212127 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)CCCOc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H20BrNO4/c1-14-5-2-7-16(11-14)21-18(22)13-25-19(23)9-4-10-24-17-8-3-6-15(20)12-17/h2-3,5-8,11-12H,4,9-10,13H2,1H3,(H,21,22) |
| InChIKey | WPHRYKYGOYKAEE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|