C38H40N12O2 — CID 20563379
1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea (PubChem CID 20563379) has the molecular formula C38H40N12O2 and a molecular weight of 696.82 g/mol. Its IUPAC name is 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea.
| Compound Name | 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 20563379 |
| Molecular Formula | C38H40N12O2 |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1.O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/2C19H20N6O/c2*26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h2*1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | VUENXHAYBSMDMS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |