C16H13F2N3O — CID 82252406
N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 82252406) has the molecular formula C16H13F2N3O and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 82252406 |
| Molecular Formula | C16H13F2N3O |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2N3O/c17-13-5-4-11(9-14(13)18)16(22)21-12-3-1-2-10(8-12)15-19-6-7-20-15/h1-5,8-9H,6-7H2,(H,19,20)(H,21,22) |
| InChIKey | XRLSPYDGROSRGD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |