C24H22N6O2S — CID 21139769
3-[(4-carbamothioylphenyl)carbamoylamino]-N-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzamide (PubChem CID 21139769) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[(4-carbamothioylphenyl)carbamoylamino]-N-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzamide.
| Compound Name | 3-[(4-carbamothioylphenyl)carbamoylamino]-N-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 21139769 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[(4-carbamothioylphenyl)carbamoylamino]-N-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzamide |
| SMILES | NC(=S)c1ccc(NC(=O)Nc2cccc(C(=O)Nc3ccc(C4=NCCN4)cc3)c2)cc1 |
| InChI | InChI=1S/C24H22N6O2S/c25-21(33)15-4-8-19(9-5-15)29-24(32)30-20-3-1-2-17(14-20)23(31)28-18-10-6-16(7-11-18)22-26-12-13-27-22/h1-11,14H,12-13H2,(H2,25,33)(H,26,27)(H,28,31)(H2,29,30,32) |
| InChIKey | BAKJAEPXFFCIHB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|