C16H15BN4O — CID 89119273
CID 89119273 (PubChem CID 89119273) has the molecular formula C16H15BN4O and a molecular weight of 290.14 g/mol.
| Compound Name | CID 89119273 |
|---|---|
| PubChem CID | 89119273 |
| Molecular Formula | C16H15BN4O |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(NC(=O)Nc2cccc(C3=NCCN3)c2)c1 |
| InChI | InChI=1S/C16H15BN4O/c17-12-4-2-6-14(10-12)21-16(22)20-13-5-1-3-11(9-13)15-18-7-8-19-15/h1-6,9-10H,7-8H2,(H,18,19)(H2,20,21,22) |
| InChIKey | IBYUWGOMDZMSOE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|