C14H10N6 — CID 168607188
2-[3-(4,5-dihydro-1H-imidazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607188) has the molecular formula C14H10N6 and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-[3-(4,5-dihydro-1H-imidazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-(4,5-dihydro-1H-imidazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607188 |
| Molecular Formula | C14H10N6 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[3-(4,5-dihydro-1H-imidazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C14H10N6/c15-7-11(8-16)13(9-17)20-12-3-1-2-10(6-12)14-18-4-5-19-14/h1-3,6,20H,4-5H2,(H,18,19) |
| InChIKey | VSODMPYBRXBCTA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|