C15H12N6 — CID 168607720
2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607720) has the molecular formula C15H12N6 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607720 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(C2=NCCCN2)cc1 |
| InChI | InChI=1S/C15H12N6/c16-8-12(9-17)14(10-18)21-13-4-2-11(3-5-13)15-19-6-1-7-20-15/h2-5,21H,1,6-7H2,(H,19,20) |
| InChIKey | GVZUFNPMZXUYMJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|