C14H20N2 — CID 154341199
2-(4-tert-butylphenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 154341199) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(4-tert-butylphenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 154341199 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | CC(C)(C)c1ccc(C2=NCCCN2)cc1 |
| InChI | InChI=1S/C14H20N2/c1-14(2,3)12-7-5-11(6-8-12)13-15-9-4-10-16-13/h5-8H,4,9-10H2,1-3H3,(H,15,16) |
| InChIKey | XPOBCKRZDTXQBO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |