C10H12N2 — CID 3746427
2-(3-methylphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 3746427) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(3-methylphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(3-methylphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 3746427 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-(3-methylphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | Cc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C10H12N2/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChIKey | FAZYMPYKTJYGNR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |