C13H12N2 — CID 11769428
2-naphthalen-2-yl-4,5-dihydro-1H-imidazole (PubChem CID 11769428) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole.
| Compound Name | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11769428 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-naphthalen-2-yl-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2cc(C3=NCCN3)ccc2c1 |
| InChI | InChI=1S/C13H12N2/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13/h1-6,9H,7-8H2,(H,14,15) |
| InChIKey | BGWRJAXPPYHIRG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |