C19H16N2 — CID 10221130
2-(4-naphthalen-1-ylphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 10221130) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(4-naphthalen-1-ylphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(4-naphthalen-1-ylphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10221130 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(4-naphthalen-1-ylphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2c(-c3ccc(C4=NCCN4)cc3)cccc2c1 |
| InChI | InChI=1S/C19H16N2/c1-2-6-17-14(4-1)5-3-7-18(17)15-8-10-16(11-9-15)19-20-12-13-21-19/h1-11H,12-13H2,(H,20,21) |
| InChIKey | NMSFRHWJYJDGAP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |