C9H13Cl2N3 — CID 131857120
4-(4,5-dihydro-1H-imidazol-2-yl)aniline;dihydrochloride (PubChem CID 131857120) has the molecular formula C9H13Cl2N3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)aniline;dihydrochloride.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)aniline;dihydrochloride |
|---|---|
| PubChem CID | 131857120 |
| Molecular Formula | C9H13Cl2N3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C9H11N3.2ClH/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;;/h1-4H,5-6,10H2,(H,11,12);2*1H |
| InChIKey | PWIYOLWKYDFWLF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|