C19H17IN2 — CID 158320426
2-(4-naphthalen-2-ylphenyl)-4,5-dihydro-1H-imidazole;hydroiodide (PubChem CID 158320426) has the molecular formula C19H17IN2 and a molecular weight of 400.26 g/mol. Its IUPAC name is 2-(4-naphthalen-2-ylphenyl)-4,5-dihydro-1H-imidazole;hydroiodide.
| Compound Name | 2-(4-naphthalen-2-ylphenyl)-4,5-dihydro-1H-imidazole;hydroiodide |
|---|---|
| PubChem CID | 158320426 |
| Molecular Formula | C19H17IN2 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-(4-naphthalen-2-ylphenyl)-4,5-dihydro-1H-imidazole;hydroiodide |
| SMILES | I.c1ccc2cc(-c3ccc(C4=NCCN4)cc3)ccc2c1 |
| InChI | InChI=1S/C19H16N2.HI/c1-2-4-17-13-18(10-7-14(17)3-1)15-5-8-16(9-6-15)19-20-11-12-21-19;/h1-10,13H,11-12H2,(H,20,21);1H |
| InChIKey | GOTXBKYEIKMLLA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|