C29H30N2O3 — CID 141119932
2-[4-[6-[4-(1-benzofuran-2-yl)phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 141119932) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[4-[6-[4-(1-benzofuran-2-yl)phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-[6-[4-(1-benzofuran-2-yl)phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 141119932 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[4-[6-[4-(1-benzofuran-2-yl)phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2oc(-c3ccc(OCCCCCCOc4ccc(C5=NCCN5)cc4)cc3)cc2c1 |
| InChI | InChI=1S/C29H30N2O3/c1(2-6-20-33-26-15-11-23(12-16-26)29-30-17-18-31-29)5-19-32-25-13-9-22(10-14-25)28-21-24-7-3-4-8-27(24)34-28/h3-4,7-16,21H,1-2,5-6,17-20H2,(H,30,31) |
| InChIKey | URLVNLYIASAHHQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|