C14H20N2O — CID 110540504
2-(4-pentoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 110540504) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(4-pentoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(4-pentoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 110540504 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-(4-pentoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCCCCOc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-2-3-4-11-17-13-7-5-12(6-8-13)14-15-9-10-16-14/h5-8H,2-4,9-11H2,1H3,(H,15,16) |
| InChIKey | BOGISOHFBIEWSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|