C32H34N4O3 — CID 11318412
2-[4-[6-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 11318412) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[4-[6-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-[6-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11318412 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[4-[6-[4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]hexoxy]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | c1cc(C2=NCCN2)ccc1OCCCCCCOc1ccc(-c2cc3ccc(C4=NCCN4)cc3o2)cc1 |
| InChI | InChI=1S/C32H34N4O3/c1(2-4-20-38-28-13-9-24(10-14-28)31-33-15-16-34-31)3-19-37-27-11-7-23(8-12-27)29-21-25-5-6-26(22-30(25)39-29)32-35-17-18-36-32/h5-14,21-22H,1-4,15-20H2,(H,33,34)(H,35,36) |
| InChIKey | YPXRBZOHDNGEPD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|