C12H16N2O2 — CID 82242139
2-[4-(2-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 82242139) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-(2-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 82242139 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | COCCOc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C12H16N2O2/c1-15-8-9-16-11-4-2-10(3-5-11)12-13-6-7-14-12/h2-5H,6-9H2,1H3,(H,13,14) |
| InChIKey | VEEXGENUJAKXHP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|